Свойство:Вещество/Формула/SMILES

Материал из Выращивание кристаллов

Основная статья: SMILES.
Это свойство типа текст.
Указывает на структурную формулу вещества, выраженную в спецификации SMILES.

20 страницы, использующих это свойство.
А
CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Gd+3]  +
CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Ho+3]  +
CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Ho+3]  +
CC(=O)[O-].CC(=O)[O-].[Fe+2]  +
CC(=O)[O-].CC(=O)[O-].[Ca+2]  +
CC([O-])=O.CC([O-])=O.[Mn+2]  +
CC(=O)[O-].CC(=O)[O-].[Cu+2]  +
CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Cu+2][Ca+2]  +
CC(=O)[O-].[Na+]  +
CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Nd+3]  +
CC(=O)[O-].CC(=O)[O-].[Ni+2]  +
CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].O.[Sm+3]  +
CC(=O)O[Pb]OC(=O)C  +
CC(=O)[O-].CC(=O)[O-].[Zn+2]  +
Б
Г
[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[K+].[K+].[K+].[K+].[Fe+2]  +
[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[Na+].[Na+].[Na+].[Na+].[Fe+2]  +
[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[K+].[K+].[K+].[Fe+3]  +

Показ 1 связанной сущности.